Paeciloquinone B | CAS No. | 162797-34-4 |
| Molecular Weight | 400.34 |
| Formula | C20H16O9 |
| SMILES | O=C(C(CCC(C)=O)C1=C(C=C2C(C3=C(C(C2=C1O)=O)C(O)=CC(O)=C3)=O)O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23260 | Stachartone A | Inquiry |
|
| MDP-23916 | Cladosporide D | Inquiry |
|
| MDP-24262 | Glidobactin B | Inquiry |
|
| MDP-22760 | Harzianoside B | Inquiry |
|
| MDP-12565 | 2'-Deoxyadenosine-5'-triphosphate | Inquiry |
|
| MDP-12098 | Ganodermanontriol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
