Paederosidic Acid | Appearance | Solid |
| CAS | 18842-98-3 |
| Purity | 99.90% |
| Molecular Weight | 464.44 |
| Formula | C18H24O12S |
| Color | White to light yellow |
| SMILES | OC[C@H]([C@@H](O)[C@H](O)[C@H]1O)O[C@@]1([H])O[C@H]2[C@@]3([H])[C@@]([C@@H](O)C=C3COC(SC)=O)([H])C(C(O)=O)=CO2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13819 | Eupalinolide B | Inquiry |
|
| PDP-16302 | Progoitrin | Inquiry |
|
| PDP-14197 | (-)-Maackiain | Inquiry |
|
| PDP-18533 | Eupteleasaponin I | Inquiry |
|
| PDP-18119 | Ophiopogonanone E | Inquiry |
|
| PDP-17963 | 20-Deoxyingenol 3-angelate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
