Paeonolide | Appearance | Solid |
| CAS | 72520-92-4 |
| Purity | 99.47% |
| Molecular Weight | 460.43 |
| Formula | C20H28O12 |
| Color | White to off-white |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1CO[C@H](OC[C@H](O)[C@@H]2O)[C@@H]2O)OC(C=C(OC)C=C3)=C3C(C)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18255 | 7-Isocarapanaubine | Inquiry |
|
| PDP-20369 | (22E,24R)-Stigmasta-4,22-dien-3-one | Inquiry |
|
| PDP-19083 | Rutaevin 7-acetate | Inquiry |
|
| PDP-16244 | Shizukaol B | Inquiry |
|
| PDP-17229 | Aloenin B | Inquiry |
|
| PDP-16283 | Icariside E4 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
