Parishin B (Standard) | CAS | 174972-79-3 |
| Molecular Weight | 728.65 |
| Formula | C32H40O19 |
| SMILES | O=C(OCC1=CC=C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C=C1)CC(O)(CC(O)=O)C(OCC3=CC=C(O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)C=C3)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19161 | (+)-Hannokinol | Inquiry |
|
| PDP-18890 | Erioside | Inquiry |
|
| PDP-13810 | (-)-Epigallocatechin Gallate (Standard) | Inquiry |
|
| PDP-18282 | Cnidioside B Methyl Ester | Inquiry |
|
| PDP-19919 | Formosanin C (Standard) | Inquiry |
|
| PDP-19202 | Dihydrocatalpol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
