Parishin C (Standard) | CAS | 174972-80-6 |
| Molecular Weight | 728.65 |
| Formula | C32H40O19 |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1CO)OC2=CC=C(COC(CC(C(O)=O)(O)CC(OCC3=CC=C(O[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO)C=C3)=O)=O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20392 | Xanthotoxol (Standard) | Inquiry |
|
| PDP-16390 | Tectoridin (Standard) | Inquiry |
|
| PDP-18404 | Goniodiol | Inquiry |
|
| PDP-13624 | 1-Deoxymannojirimycin Hydrochloride | Inquiry |
|
| PDP-17670 | Qianhucoumarin B | Inquiry |
|
| PDP-14377 | Alloimperatorin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
