Parishin | Appearance | Solid |
| CAS | 62499-28-9 |
| Purity | 99.77% |
| Molecular Weight | 996.91 |
| Formula | C45H56O25 |
| Color | Off-white to light yellow |
| SMILES | O[C@H]([C@@H](O)[C@@H]1O)[C@@H](O[C@@H]1CO)OC2=CC=C(COC(C(CC(OCC3=CC=C(O[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO)C=C3)=O)(O)CC(OCC5=CC=C(O[C@@H]([C@@H]([C@@H](O)[C@@H]6O)O)O[C@@H]6CO)C=C5)=O)=O)C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18869 | Coreopsin | Inquiry |
|
| PDP-20292 | Chlorantholide C | Inquiry |
|
| PDP-13925 | 4-Hydroxybenzylamine | Inquiry |
|
| PDP-16673 | Gartanin | Inquiry |
|
| PDP-14749 | Irisolidone | Inquiry |
|
| PDP-17592 | 17(13→14)-Abeo-ent-3S*,13S*,16-trihydroxystrob-8(15)-ene | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
