Paulomycin A | CAS No. | 81988-77-4 |
| Synonyms | Volonomycin A |
| Molecular Weight | 786.80 |
| Formula | C34H46N2O17S |
| SMILES | CC[C@@H](C(O[C@H]([C@@]1(O)[C@H](C)O[C@@H](O[C@H]2[C@@H](O)[C@H]([C@@]3(O)CC(C(C(C(O)=O)=C3O)=N)=O)O[C@H](COC(C)=O)[C@H]2OC(/C(N=C=S)=C/C)=O)C[C@@H]1OC)C)=O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12443 | Erinacin B | Inquiry |
|
| MDP-23507 | Aspersitin | Inquiry |
|
| MDP-24088 | Epicillin | Inquiry |
|
| MDP-23390 | Urea (Standard) | Inquiry |
|
| MDP-24332 | Chlorogentisylquinone | Inquiry |
|
| MDP-11461 | Adenosine 5'-diphosphoribose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.