Pedalitin | CAS | 22384-63-0 |
| Molecular Weight | 316.26 |
| Formula | C16H12O7 |
| SMILES | O=C1C=C(C2=CC=C(O)C(O)=C2)OC3=CC(OC)=C(O)C(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17864 | 2,2'-Dihydroxy-4,6-dimethoxy-3-methylacetophenone | Inquiry |
|
| PDP-19426 | Ptelatoside B | Inquiry |
|
| PDP-15175 | Helicin | Inquiry |
|
| PDP-19785 | Notopterol (Standard) | Inquiry |
|
| PDP-14257 | 2'-Hydroxyacetophenone | Inquiry |
|
| PDP-17457 | (20S)-Protopanaxadiol-3-one | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
