Pedunculosumoside F | CAS | 1283600-08-7 |
| Molecular Weight | 640.54 |
| Formula | C28H32O17 |
| SMILES | OCC1=C(C2=CC(O)=C(C=C2)O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)OC4=CC(O[C@@H]5O[C@@H]([C@H]([C@@H]([C@H]5O)O)O)CO)=CC(O)=C4C1=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19518 | Ecdysoside B | Inquiry |
|
| PDP-15289 | Sarracenin | Inquiry |
|
| PDP-17536 | Tsugafolin | Inquiry |
|
| PDP-17482 | Z-Antiepilepsirine | Inquiry |
|
| PDP-17233 | Stigmane B | Inquiry |
|
| PDP-16193 | Licoisoflavanone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
