Pentagalloylglucose (Standard) | CAS | 14937-32-7 |
| Molecular Weight | 940.68 |
| Formula | C41H32O26 |
| SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@@H]([C@@H]([C@@H](COC(C2=CC(O)=C(O)C(O)=C2)=O)O3)OC(C4=CC(O)=C(O)C(O)=C4)=O)[C@H]([C@@H]3OC(C5=CC(O)=C(O)C(O)=C5)=O)OC(C6=CC(O)=C(O)C(O)=C6)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16447 | Cixiophiopogon A | Inquiry |
|
| PDP-14770 | Picrotin | Inquiry |
|
| PDP-20061 | Lycorine Hydrochloride (Standard) | Inquiry |
|
| PDP-19909 | Hosenkoside B (Standard) | Inquiry |
|
| PDP-17655 | 9α-Hydroxymatrine | Inquiry |
|
| PDP-20470 | Catharanthine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.