Phellodendrine | Appearance | Solid |
| CAS | 6873-13-8 |
| Purity | 99.60% |
| Molecular Weight | 342.41 |
| Formula | C20H24NO4 |
| Color | Off-white to light yellow |
| SMILES | OC1=C(OC)C=C2CC[N@@+]3(C)CC4=CC(OC)=C(O)C=C4C[C@@]3([H])C2=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16716 | Bonducellpin D | Inquiry |
|
| PDP-14920 | Glucotropaeolin Potassium | Inquiry |
|
| PDP-18401 | 1-(26-Hydroxyhexacosanoyl)-glycerol | Inquiry |
|
| PDP-14227 | Rhodiosin | Inquiry |
|
| PDP-19175 | Procyanidin B2 3,3'-di-O-gallate | Inquiry |
|
| PDP-18634 | 11-Deoxymogroside IIE | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
