Piceatannol 3'-O-glucoside (Standard) | CAS | 94356-26-0 |
| Molecular Weight | 406.38 |
| Formula | C20H22O9 |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1OC2=CC(/C=C/C3=CC(O)=CC(O)=C3)=CC=C2O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16708 | Amaronol B | Inquiry |
|
| PDP-19679 | Bacopasaponin C (Standard) | Inquiry |
|
| PDP-20082 | Napelline | Inquiry |
|
| PDP-16704 | Dihydrotamarixetin | Inquiry |
|
| PDP-20286 | Akuammiline | Inquiry |
|
| PDP-15449 | Spinacetin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
