Picropodophyllin-4-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside | CAS | 619296-83-2 |
| Molecular Weight | 738.69 |
| Formula | C34H42O18 |
| SMILES | O=C1[C@@]2([H])[C@H](C3=CC(OC)=C(C(OC)=C3)OC)C4=CC(OCO5)=C5C=C4[C@@H]([C@@]2([H])CO1)O[C@@H]6O[C@@H]([C@H]([C@@H]([C@H]6O)O)O)CO[C@@H]7O[C@@H]([C@H]([C@@H]([C@H]7O)O)O)CO |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13344 | Cryptochlorogenic Acid | Inquiry |
|
| PDP-18882 | Rupesin E | Inquiry |
|
| PDP-15368 | 3'-Hydroxypuerarin | Inquiry |
|
| PDP-16166 | Podecdysone B | Inquiry |
|
| PDP-20526 | Hydroxysafflor Yellow A (Standard) | Inquiry |
|
| PDP-16120 | Saikosaponin G | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
