Pilocarpine Nitrate (Standard) | CAS | 148-72-1 |
| Molecular Weight | 271.27 |
| Formula | C11H17N3O5 |
| SMILES | [O-][N+](O)=O.O=C1OC[C@H](CC2=CN=CN2C)[C@@H]1CC |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14088 | Fortunellin | Inquiry |
|
| PDP-17583 | 16β-Hydroperoxyalisol B 23-acetate | Inquiry |
|
| PDP-14426 | Flavanone | Inquiry |
|
| PDP-14204 | Cyclogalegenin | Inquiry |
|
| PDP-14563 | Bakkenolide A | Inquiry |
|
| PDP-14471 | Zingiberen Newsaponin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
