(+)-Piperitol-3,3-dimethylallyl Ether | CAS | 157659-20-6 |
| Molecular Weight | 424.49 |
| Formula | C25H28O6 |
| SMILES | C/C(C)=C/COC1=CC=C([C@H]2OC[C@]3([H])[C@@H](C4=CC=C(OCO5)C5=C4)OC[C@@]32[H])C=C1OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14282 | Ledol | Inquiry |
|
| PDP-17173 | 10-O-Methylprotosappanin B | Inquiry |
|
| PDP-15213 | Hygric Acid | Inquiry |
|
| PDP-13243 | Indole-3-carbinol | Inquiry |
|
| PDP-18252 | Isoderrone | Inquiry |
|
| PDP-16965 | Vinleurosine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
