Piperolactam A | CAS | 112501-42-5 |
| Molecular Weight | 265.26 |
| Formula | C16H11NO3 |
| SMILES | O=C1NC2=C3C1=CC(OC)=C(O)C3=C4C(C=CC=C4)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20352 | Xanthiside | Inquiry |
|
| PDP-19378 | Tirotundin | Inquiry |
|
| PDP-19755 | Licochalcone A (Standard) | Inquiry |
|
| PDP-13941 | Garcinone D | Inquiry |
|
| PDP-16462 | Agalloside | Inquiry |
|
| PDP-14571 | Cannflavin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
