Platycodin D2 | Appearance | Solid |
| CAS | 66663-90-9 |
| Purity | 99.36% |
| Molecular Weight | 1387.46 |
| Formula | C63H102O33 |
| Color | Off-white to light yellow |
| SMILES | O[C@H]([C@@H]([C@@H](O[C@@]1([H])[C@@H]([C@H]([C@H](O)CO1)O[C@@]2([H])[C@@H]([C@](CO)(O)CO2)O)O)[C@H](C)O3)O)[C@]3([H])O[C@H]([C@H]([C@@H](O)CO4)O)[C@@H]4OC([C@]56[C@](CC(C)(C)CC6)([H])C7=CC[C@@]([C@@]8([C@@](C(CO)([C@@H](O[C@@]9([H])[C@@H]([C@H]([C@H](O)[C@@H](CO)O9)O[C@]%10([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]%10O)CO)O)[C@@H](O)C8)CO)([H])CC%11)C)([H])[C@]%11(C)[C@]7(C)C[C@H]5O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19273 | Valerena-4,7(11)-diene | Inquiry |
|
| PDP-20282 | Polygalasaponin XXVIII | Inquiry |
|
| PDP-15126 | Cauloside F | Inquiry |
|
| PDP-16865 | Acuminatin | Inquiry |
|
| PDP-17575 | 5,7-Dihydroxycoumarin 7-O-β-D-glucopyranoside | Inquiry |
|
| PDP-15113 | Morellic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
