Plicacetin | CAS No. | 43043-15-8 |
| Molecular Weight | 517.57 |
| Formula | C25H35N5O7 |
| SMILES | O=C(NC(C=CN1[C@H]2CC[C@H](O[C@@H]3[C@@H]([C@H]([C@H](N(C)C)[C@@H](C)O3)O)O)[C@@H](C)O2)=NC1=O)C4=CC=C(N)C=C4 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21875 | Neosolaniol | Inquiry |
|
| MDP-12651 | Piliformic Acid | Inquiry |
|
| MDP-22550 | Fistupyrone | Inquiry |
|
| MDP-23800 | Neomycin F | Inquiry |
|
| MDP-23444 | Andrastin B | Inquiry |
|
| MDP-12636 | Tajixanthone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
