Pochonin D | CAS No. | 544712-82-5 |
| Synonyms | (+)-Pochonin D |
| Molecular Weight | 350.79 |
| Formula | C18H19ClO5 |
| SMILES | ClC1=C2C(C(O[C@@H](C/C=C/CC/C=C/C(C2)=O)C)=O)=C(C=C1O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23753 | Louisianin A | Inquiry |
|
| MDP-12295 | δ-Decalactone | Inquiry |
|
| MDP-11215 | Diprotin A | Inquiry |
|
| MDP-23077 | Chitinovorin B | Inquiry |
|
| MDP-23945 | Halomicin D | Inquiry |
|
| MDP-12213 | L-Cystine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
