Polygalaxanthone XI | Appearance | Solid |
| CAS | 857859-82-6 |
| Purity | ≥99.0% |
| Molecular Weight | 568.48 |
| Formula | C25H28O15 |
| Color | Light yellow to yellow |
| SMILES | OC1=C2C(OC3=CC(O)=C(OC)C=C3C2=O)=CC(O)=C1[C@H]4[C@@H]([C@H]([C@H](O)[C@@H](CO)O4)O)O[C@@]5([H])[C@@H]([C@](CO)(O)CO5)O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15444 | Isosilybin B | Inquiry |
|
| PDP-19368 | 28-Deoxonimbolide | Inquiry |
|
| PDP-13491 | (E)-β-Farnesene | Inquiry |
|
| PDP-17736 | Nortrachelogenin 4'-O-β-gentiobioside | Inquiry |
|
| PDP-16198 | β-Hederin | Inquiry |
|
| PDP-16132 | Eurycomalactone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
