Polymyxin M | CAS No. | 6683-17-6 |
| Molecular Weight | 1157.41 |
| Formula | C51H96N16O14 |
| SMILES | CCC(C)CCCCC(N[C@@H](CCN)C(N[C@@H]([C@H](O)C)C(N[C@@H](CCN)C(N[C@@H]1C(N[C@H](C(N[C@@H](C(N[C@@](C(N[C@H](C(N[C@H](C(N[C@@](C(NCC1)=O)([H])[C@H](O)C)=O)CCN)=O)CCN)=O)([H])[C@H](O)C)=O)CC(C)C)=O)CCN)=O)=O)=O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23974 | Nisamycin | Inquiry |
|
| MDP-11387 | Leucocyanidin | Inquiry |
|
| MDP-23248 | D-Phenylalanine (Standard) | Inquiry |
|
| MDP-11679 | Dimethyl Trisulfide | Inquiry |
|
| MDP-23904 | Coriolin B | Inquiry |
|
| MDP-23960 | Mycoplanecin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
