Ponicidin | Synonyms | Rubescensine B |
| Appearance | Solid |
| CAS | 52617-37-5 |
| Purity | 99.93% |
| Molecular Weight | 362.42 |
| Formula | C20H26O6 |
| Color | White to off-white |
| SMILES | O[C@]12[C@]3(C4=O)[C@]5([H])C6([C@](O[C@@]3([H])[C@](CC5)([H])C4=C)([H])O2)[C@](C(C)(CC[C@@H]6O)C)([H])[C@@H]1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17945 | 2,16,19-Kauranetriol 2-O-β-D-allopyranoside | Inquiry |
|
| PDP-20127 | 23-epi-26-Deoxyactein (Standard) | Inquiry |
|
| PDP-13386 | Momordin Ic | Inquiry |
|
| PDP-13719 | alpha-Asarone | Inquiry |
|
| PDP-16742 | Dichotomine B | Inquiry |
|
| PDP-13722 | Arglabin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.