Prehelminthosporol | CAS No. | 1619-13-2 |
| Molecular Weight | 236.35 |
| Formula | C15H24O2 |
| SMILES | OC1C(C2=C)C3C(C2(C)CCC3C(C)C)CO1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11644 | Lithium Citrate Tetrahydrate | Inquiry |
|
| MDP-23578 | 2-Hydroxyaclacinomycin B | Inquiry |
|
| MDP-10997 | SAH | Inquiry |
|
| MDP-11283 | L-Theanine | Inquiry |
|
| MDP-22723 | 3-Indoleacetonitrile (Standard) | Inquiry |
|
| MDP-12726 | Sadopeptins B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
