Pristinamycin IA (Standard) | CAS No. | 3131-03-1 |
| Synonyms | Mikamycin B (Standard); Mikamycin IA (Standard) |
| Molecular Weight | 866.96 |
| Formula | C45H54N8O10 |
| SMILES | O=C(N[C@@H]1C(N[C@H](CC)C(N2[C@](CCC2)([H])C(N(C)[C@@H](CC3=CC=C(N(C)C)C=C3)C(N4[C@](CC(CC4)=O)([H])C(N[C@@H](C5=CC=CC=C5)C(O[C@@H]1C)=O)=O)=O)=O)=O)=O)C6=NC=CC=C6O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22780 | Coproporphyrin III (Standard) | Inquiry |
|
| MDP-11417 | Engeletin | Inquiry |
|
| MDP-12608 | 2,7-Dimethoxy-6-(1-acetoxyethyl)juglone | Inquiry |
|
| MDP-24341 | Miyakamide B1 | Inquiry |
|
| MDP-11001 | Adenosine Monophosphate | Inquiry |
|
| MDP-23268 | 4-Trehalosamine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
