Propioxatin B | CAS No. | 102962-95-8 |
| Molecular Weight | 385.46 |
| Formula | C18H31N3O6 |
| SMILES | O=C(C(C(C)C)NC(C1N(CCC1)C(C(CC(C)C)CC(NO)=O)=O)=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23958 | Menoxymycin A | Inquiry |
|
| MDP-23089 | Lankamycin | Inquiry |
|
| MDP-23949 | Leptofuranin A | Inquiry |
|
| MDP-24062 | Macquarimicin B | Inquiry |
|
| MDP-12675 | Epicoccone B | Inquiry |
|
| MDP-22870 | 21-Hydroxyoligomycin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
