Proscillaridin A (Standard) | CAS | 466-06-8 |
| Molecular Weight | 530.65 |
| Formula | C30H42O8 |
| SMILES | O[C@@]([C@@]1(CC2)C)(CC[C@@H]1C(C=C3)=COC3=O)[C@@](CCC4=C[C@@H](O[C@@](O[C@@H](C)[C@H](O)[C@H]5O)([H])[C@@H]5O)CC6)([H])[C@@]2([H])[C@]46C |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-12952 | Baobab Extract | Inquiry |
|
| PDP-16247 | Chlojaponilactone B | Inquiry |
|
| PDP-15231 | O-Desmethyl Galanthamine | Inquiry |
|
| PDP-19855 | Vincetoxicoside B (Standard) | Inquiry |
|
| PDP-13001 | Rosemary Extract | Inquiry |
|
| PDP-15900 | 3-Methylcarbazole | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
