Protostemotinine | Appearance | Solid |
| CAS | 169534-85-4 |
| Purity | 98.07% |
| Molecular Weight | 415.48 |
| Formula | C23H29NO6 |
| Color | Off-white to light yellow |
| SMILES | COC([C@@](C1=O)(OC2=O)[C@]3(C4=C1C)N(CCCC4)[C@@]([C@](O5)([H])C[C@H](C)C5=O)([H])CC3)=C2C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15006 | Kushenol I | Inquiry |
|
| PDP-19433 | Preschisanartanin B | Inquiry |
|
| PDP-18876 | Flavidin | Inquiry |
|
| PDP-20453 | Amygdalin (Standard) | Inquiry |
|
| PDP-14789 | (+)-Camphor | Inquiry |
|
| PDP-20073 | α-Glucosidase-IN-70 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
