β-Prumycin Hydrochloride | CAS No. | 54612-74-7 |
| Molecular Weight | 292.16 |
| Formula | C8H19Cl2N3O4 |
| SMILES | C[C@@H](N)C(N[C@@H]1[C@@H]([C@H]([C@H](OC1)O)N)O)=O.Cl.Cl |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23520 | Auramycin B | Inquiry |
|
| MDP-22981 | Altromycin E | Inquiry |
|
| MDP-11434 | Pepstatin Ammonium | Inquiry |
|
| MDP-23372 | Calcimycin (Standard) | Inquiry |
|
| MDP-22203 | Dopamine (hydrochloride) (Standard) | Inquiry |
|
| MDP-22122 | 5-Methylfurfural (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
