Pterosin B | Appearance | Solid |
| CAS | 34175-96-7 |
| Purity | 99.92% |
| Molecular Weight | 218.30 |
| Formula | C14H18O2 |
| Color | White to light yellow |
| SMILES | O=C1[C@H](C)CC2=C1C(C)=C(CCO)C(C)=C2 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16461 | Linustatin | Inquiry |
|
| PDP-19087 | Cnidimol A | Inquiry |
|
| PDP-18753 | Escin Ie | Inquiry |
|
| PDP-19447 | (2,4-Dihydroxyphenyl)acetonitrile | Inquiry |
|
| PDP-16166 | Podecdysone B | Inquiry |
|
| PDP-16444 | (E)-Cinnamamide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
