Pyralomicin 2c | CAS No. | 139636-01-4 |
| Molecular Weight | 460.26 |
| Formula | C19H19Cl2NO8 |
| SMILES | ClC1=CC(C(C2=C(O)C(C)=CC(Cl)=C2O3)=O)=C3N1[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)OC)CO |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12314 | T-Muurolol | Inquiry |
|
| MDP-24244 | Pradimicin B | Inquiry |
|
| MDP-23843 | Paulomenol B | Inquiry |
|
| MDP-11566 | Manninotriose | Inquiry |
|
| MDP-22918 | Zaragozic Acid D2 | Inquiry |
|
| MDP-11559 | Enterobactin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
