Pyrazomycin Ⅱ | CAS No. | 41855-21-4 |
| Synonyms | Pyrazomycin B |
| Molecular Weight | 259.22 |
| Formula | C9H13N3O6 |
| SMILES | O[C@H]1[C@@H](C2=C(C(C(N)=O)=NN2)O)O[C@@H]([C@H]1O)CO |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11609 | D-(+)-Malic Acid | Inquiry |
|
| MDP-11935 | 2,3-Pentanedione | Inquiry |
|
| MDP-10961 | Cytochalasin D | Inquiry |
|
| MDP-11054 | Pyruvic Acid | Inquiry |
|
| MDP-23940 | Feigrisolide A | Inquiry |
|
| MDP-12187 | Lucidenic Acid B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
