Pyrethrolone | CAS | 487-67-2 |
| Molecular Weight | 180.24 |
| Formula | C11H16O2 |
| SMILES | CC/C=C\CC1=C([C@H](CC1=O)O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15282 | Dihydroartemisinic Acid | Inquiry |
|
| PDP-15674 | Daidzein-4',7-diglucoside | Inquiry |
|
| PDP-17564 | Carmichasine B | Inquiry |
|
| PDP-16280 | Stigmasta-4,22-dien-3-one | Inquiry |
|
| PDP-20329 | Galangin (Standard) | Inquiry |
|
| PDP-20357 | Alstonidine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
