Pyridoxal Phosphate (Standard) | CAS No. | 54-47-7 |
| Molecular Weight | 247.14 |
| Formula | C₈H₁₀NO₆P |
| Appearance | Solid |
| Color | Off-white to light yellow |
| SMILES | O=CC1=C(O)C(C)=NC=C1COP(O)(O)=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-10999 | α-Linolenic Acid | Inquiry |
|
| MDP-11210 | Mizoribine | Inquiry |
|
| MDP-12468 | (-)-Cyclopenin | Inquiry |
|
| MDP-12685 | Sarbronine M | Inquiry |
|
| MDP-22191 | Dactylocycline A | Inquiry |
|
| MDP-12628 | Thielavin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
