Pyripyropene B | CAS No. | 151519-44-7 |
| Molecular Weight | 597.65 |
| Formula | C32H39NO10 |
| SMILES | C[C@@]12[C@]3([H])[C@@]([C@H](C[C@@]1([H])[C@@](C)([C@H](CC2)OC(C)=O)COC(CC)=O)OC(C)=O)(OC4=C(C(OC(C5=CN=CC=C5)=C4)=O)[C@@H]3O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22865 | Illudalic Acid | Inquiry |
|
| MDP-23449 | AK-toxin Ⅰ | Inquiry |
|
| MDP-23222 | α-Humulene (Standard) | Inquiry |
|
| MDP-23146 | Filipin II | Inquiry |
|
| MDP-12643 | Agonodepside B | Inquiry |
|
| MDP-22555 | Ferrocin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
