Pyrroside B | CAS | 116271-35-3 |
| Molecular Weight | 566.51 |
| Formula | C26H30O14 |
| SMILES | O=C1C2=C(O)C=C(O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO[C@H]4[C@@H]([C@](O)(CO4)CO)O)C=C2O[C@H](C5=CC=C(C=C5)O)C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13340 | Madecassoside | Inquiry |
|
| PDP-15378 | Decursinol Angelate | Inquiry |
|
| PDP-16556 | Kaempferol-3-O-β-D-6''-acetylglucoside | Inquiry |
|
| PDP-14978 | Allyl Methyl Trisulfide | Inquiry |
|
| PDP-15624 | Ferruginol | Inquiry |
|
| PDP-18532 | 6'-O-β-Apiofuranosylsweroside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
