Quercetin-3'-O-glucoside | Appearance | Solid |
| CAS | 19254-30-9 |
| Purity | 98.48% |
| Molecular Weight | 464.38 |
| Formula | C21H20O12 |
| Color | Off-white to light yellow |
| SMILES | O=C1C2=C(O)C=C(O)C=C2OC(C3=CC(O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)=C(C=C3)O)=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19188 | Guttiferone G | Inquiry |
|
| PDP-15077 | Pteryxin | Inquiry |
|
| PDP-17877 | 4-Aminophenyl 6-deoxy-α-L-mannopyranoside | Inquiry |
|
| PDP-14365 | 2-Methylcyclopentane-1,3-dione | Inquiry |
|
| PDP-17673 | Kingiside | Inquiry |
|
| PDP-14326 | L-(+)-Abrine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
