Quercetin-3,7-di-O-a-rhamnopyranoside | Synonyms | Quercetin 3,7-dirhamnoside |
| Appearance | Solid |
| CAS | 28638-13-3 |
| Purity | ≥98.0% |
| Molecular Weight | 594.52 |
| Formula | C27H30O15 |
| Color | Light yellow to yellow |
| SMILES | O=C(C(O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)=C(C2=CC(O)=C(C=C2)O)OC3=CC(O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O)=C5)C3=C5O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20448 | Cryptotanshinone (Standard) | Inquiry |
|
| PDP-14890 | Kaempferol 3-O-gentiobioside | Inquiry |
|
| PDP-15365 | Ferutinin | Inquiry |
|
| PDP-14378 | Martynoside | Inquiry |
|
| PDP-14547 | Ilexsaponin A | Inquiry |
|
| PDP-17509 | Dihydroisocucurbitacin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
