(R)-1-PeCSO | Synonyms | Isoalliin; Trans-(+)-S-1-Propenyl-L-cysteine Sulfoxide |
| Appearance | Solid |
| CAS | 16718-23-3 |
| Purity | 99.50% |
| Molecular Weight | 177.22 |
| Formula | C6H11NO3S |
| Color | White to light brown |
| SMILES | OC([C@@H](N)C[S@](/C=C/C)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17928 | Ent-16α,17-dihydroxykauran-3-one | Inquiry |
|
| PDP-15614 | Macranthoside B | Inquiry |
|
| PDP-14552 | Neoprzewaquinone A | Inquiry |
|
| PDP-13032 | Grape Seed Extract | Inquiry |
|
| PDP-14591 | Curzerenone | Inquiry |
|
| PDP-17823 | Angustanoic Acid G | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
