(R)-Eucomol | CAS | 118204-64-1 |
| Molecular Weight | 316.31 |
| Formula | C17H16O6 |
| SMILES | O=C1[C@](CC2=CC=C(OC)C=C2)(O)COC3=CC(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16194 | Entadamide-A-β-D-glucopyranoside | Inquiry |
|
| PDP-16089 | Chloramultilide B | Inquiry |
|
| PDP-19612 | Epinodosin | Inquiry |
|
| PDP-17256 | 8α,9α-Epoxycoleon-U-quinone | Inquiry |
|
| PDP-20442 | Quercetin (dihydrate) (Standard) | Inquiry |
|
| PDP-17698 | Isorabaichromone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
