Rabdosin B | CAS | 84304-92-7 |
| Molecular Weight | 448.51 |
| Formula | C24H32O8 |
| SMILES | CC(OC[C@H](C1(C)C)[C@]([C@H](CC1)OC(C)=O)(COC2=O)[C@@]3([H])[C@]2(C(C4=C)=O)C[C@@]4([H])C[C@@H]3O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14506 | Agarotetrol | Inquiry |
|
| PDP-14650 | Pulchinenoside A | Inquiry |
|
| PDP-17840 | Cynatratoside D | Inquiry |
|
| PDP-18649 | 7-Hydroxy-5-methoxycoumarin | Inquiry |
|
| PDP-13288 | Aucubin | Inquiry |
|
| PDP-14088 | Fortunellin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
