(rac)-Secodihydro-hydramicromelin B | CAS | 1212148-58-7 |
| Molecular Weight | 326.30 |
| Formula | C15H18O8 |
| SMILES | O=C(O)CCC1=CC(C(C(O)C2(O)C)OC2=O)=C(OC)C=C1O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16674 | Neosmitilbin | Inquiry |
|
| PDP-16815 | 1,11b-Dihydro-11b-hydroxymaackiain | Inquiry |
|
| PDP-15842 | Mosloflavone | Inquiry |
|
| PDP-13100 | Methylliberine | Inquiry |
|
| PDP-17444 | Stellarine C | Inquiry |
|
| PDP-19021 | Pachysamine M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
