Racemomycin B | CAS No. | 3776-37-2 |
| Synonyms | 229-B; Streptothricin D |
| Molecular Weight | 758.87 |
| Formula | C31H58N12O10 |
| SMILES | O=C(NC[C@H]1O)[C@]2([H])[C@]1([H])NC(N[C@H]3[C@@H]([C@@H]([C@@H](OC(N)=O)[C@@H](CO)O3)O)NC(C[C@@H](N)CCCNC(C[C@@H](N)CCCNC(C[C@@H](N)CCCN)=O)=O)=O)=N2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12313 | 5-Aminoimidazole Ribonucleotide | Inquiry |
|
| MDP-24103 | 7β,8β-2',3'-Diepoxyroridin H | Inquiry |
|
| MDP-21891 | Territrem A | Inquiry |
|
| MDP-11608 | Myrcene | Inquiry |
|
| MDP-23995 | Cyclophellitol | Inquiry |
|
| MDP-12539 | Globosuxanthone A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
