Rehmannioside B | CAS | 81720-06-1 |
| Molecular Weight | 524.47 |
| Formula | C21H32O15 |
| SMILES | OC[C@@]12[C@@]([C@H]([C@@]3([H])[C@]2([H])[C@@H](OC=C3)O[C@@H]4O[C@@H]([C@H]([C@@H]([C@H]4O)O)O)CO)O[C@H]5O[C@@H]([C@@H]([C@@H]([C@H]5O)O)O)CO)([H])O1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14079 | β-Tocopherol | Inquiry |
|
| PDP-17797 | Centellasaponin A | Inquiry |
|
| PDP-16220 | Polyporusterone B | Inquiry |
|
| PDP-17736 | Nortrachelogenin 4'-O-β-gentiobioside | Inquiry |
|
| PDP-17946 | 2,16-Kauranediol | Inquiry |
|
| PDP-14918 | Bornyl Acetate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
