Rehmannioside D (Standard) | CAS | 81720-08-3 |
| Molecular Weight | 686.61 |
| Formula | C27H42O20 |
| SMILES | O[C@H]1[C@@]([C@](C(CO)=C1)([H])[C@@H]2O[C@]([C@@H]([C@@H](O)[C@@H]3O)O)([H])O[C@@H]3CO)(C=CO2)O[C@@](O[C@H](CO)[C@@H](O)[C@@H]4O)([H])[C@@H]4O[C@]([C@@H]([C@@H](O)[C@@H]5O)O)([H])O[C@@H]5CO |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20337 | Torososide B | Inquiry |
|
| PDP-17328 | (19R,23E)-5b,19-Epoxy19-ethoxycucurbita-6,23-diene-3b,25-diol | Inquiry |
|
| PDP-15800 | Isolongifolene | Inquiry |
|
| PDP-17428 | 9-Hydroxythymol | Inquiry |
|
| PDP-15780 | Pinocembrin Chalcone | Inquiry |
|
| PDP-19122 | 6"-Acetylhyperin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
