Rhazimine | CAS | 93772-08-8 |
| Molecular Weight | 350.41 |
| Formula | C21H22N2O3 |
| SMILES | C/C=C1[C@H]2C[C@H]3N(CC[C@@]4([C@]2(C=NC5=CC=CC=C54)C(OC)=O)C3=O)C/1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19308 | Sumaresinolic Acid | Inquiry |
|
| PDP-18248 | Isogarciniaxanthone E | Inquiry |
|
| PDP-17788 | Glycoside St-J | Inquiry |
|
| PDP-18971 | Umckalin | Inquiry |
|
| PDP-14335 | Vincetoxicoside B | Inquiry |
|
| PDP-16046 | Atractylone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
