Roridin H | CAS No. | 29953-50-2 |
| Synonyms | Verrucarin H |
| Molecular Weight | 512.59 |
| Formula | C29H36O8 |
| SMILES | C[C@@]1([C@](CCC(C)=C2)(COC3=O)[C@]2([H])O4)[C@]5(CO5)[C@@]4([H])C[C@@]1([H])OC(/C=C\C=C\C6CCOC(O6)C/C(C)=C\3)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11334 | 1-Aminocyclopropane-1-carboxylic Acid | Inquiry |
|
| MDP-22207 | Nivalenol (Standard) | Inquiry |
|
| MDP-11183 | Coumermycin A1 | Inquiry |
|
| MDP-11229 | Penicillin G Potassium | Inquiry |
|
| MDP-12623 | Dihydroaltenuene B | Inquiry |
|
| MDP-23412 | Arginomycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
