Rubomycin H | CAS No. | 38942-79-9 |
| Molecular Weight | 585.56 |
| Formula | C29H31NO12 |
| SMILES | OC1=C2C(C(C3=C(OC)C=CC=C3C2=O)=O)=C(O)C([C@H]4O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O)NC(OC)=O)=C1C[C@](O)(C4)C(C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23914 | Chloropolysporin B | Inquiry |
|
| MDP-23747 | Glysperin B | Inquiry |
|
| MDP-22242 | Lauroyl Coenzyme A | Inquiry |
|
| MDP-11224 | Apicidin | Inquiry |
|
| MDP-23508 | Actamycin | Inquiry |
|
| MDP-23041 | 1,4-Dihydro-1,2-dimethyl-4-oxo-3-quinolinecarboxylic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
