Rubone | Appearance | Solid |
| CAS | 73694-15-2 |
| Purity | 99.1% |
| Molecular Weight | 374.38 |
| Formula | C20H22O7 |
| Color | Light yellow to yellow |
| SMILES | O=C(/C=C/C1=CC(OC)=C(C=C1OC)OC)C2=C(C=C(C=C2O)OC)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15194 | 4'-Hydroxy-3'-methylacetophenone | Inquiry |
|
| PDP-15671 | Malabaricone B | Inquiry |
|
| PDP-18283 | Coccinic Acid | Inquiry |
|
| PDP-14466 | Licraside | Inquiry |
|
| PDP-18808 | Gardoside | Inquiry |
|
| PDP-14434 | Arteannuin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
