(S)-10-Hydroxycamptothecin (Standard) | CAS | 19685-09-7 |
| Molecular Weight | 364.35 |
| Formula | C₂₀H₁₆N₂O₅ |
| SMILES | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=CC(O)=CC=C5N=C4C3=C2)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13249 | Yohimbine Hydrochloride | Inquiry |
|
| PDP-20063 | Solanesol (Standard) | Inquiry |
|
| PDP-15348 | Ganoderol B | Inquiry |
|
| PDP-14758 | Isovanillin | Inquiry |
|
| PDP-17729 | Isobatatasin I | Inquiry |
|
| PDP-16345 | Sugiol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
