Saikosaponin D (Standard) | CAS | 20874-52-6 |
| Molecular Weight | 780.98 |
| Formula | C42H68O13 |
| SMILES | CC1(C)CC[C@]2(CO3)[C@H](O)C[C@@]4(C)[C@]([C@]5([H])C=C[C@]43[C@]2([H])C1)(C)CC[C@@]([C@]5(C)CC6)([H])[C@@](CO)(C)[C@H]6O[C@@](O[C@H](C)[C@@H]7O)([H])[C@H](O)[C@H]7O[C@@]8([H])[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O8 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16716 | Bonducellpin D | Inquiry |
|
| PDP-13821 | Schisandrol B | Inquiry |
|
| PDP-17645 | 1-O-trans-Cinnamoyl-β-D-glucopyranose | Inquiry |
|
| PDP-17560 | Bupleuroside XIII | Inquiry |
|
| PDP-16035 | A2AAR Antagonist 2 | Inquiry |
|
| PDP-17888 | 8-Methoxykaempferol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
